C26H22ClFN2O3 — CID 110586021
1-[(4-chlorophenyl)methyl]-3-(4-fluorophenyl)-4-(3-propoxyanilino)pyrrole-2,5-dione (PubChem CID 110586021) has the molecular formula C26H22ClFN2O3 and a molecular weight of 464.92 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-(4-fluorophenyl)-4-(3-propoxyanilino)pyrrole-2,5-dione.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-(4-fluorophenyl)-4-(3-propoxyanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110586021 |
| Molecular Formula | C26H22ClFN2O3 |
| Molecular Weight | 464.92 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-(4-fluorophenyl)-4-(3-propoxyanilino)pyrrole-2,5-dione |
| SMILES | CCCOc1cccc(NC2=C(c3ccc(F)cc3)C(=O)N(Cc3ccc(Cl)cc3)C2=O)c1 |
| InChI | InChI=1S/C26H22ClFN2O3/c1-2-14-33-22-5-3-4-21(15-22)29-24-23(18-8-12-20(28)13-9-18)25(31)30(26(24)32)16-17-6-10-19(27)11-7-17/h3-13,15,29H,2,14,16H2,1H3 |
| InChIKey | FIHKLSNVDVDLPX-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.92 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|