C25H23N3O3 — CID 110594393
3-phenyl-4-(3-propoxyanilino)-1-(pyridin-3-ylmethyl)pyrrole-2,5-dione (PubChem CID 110594393) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is 3-phenyl-4-(3-propoxyanilino)-1-(pyridin-3-ylmethyl)pyrrole-2,5-dione.
| Compound Name | 3-phenyl-4-(3-propoxyanilino)-1-(pyridin-3-ylmethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110594393 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 3-phenyl-4-(3-propoxyanilino)-1-(pyridin-3-ylmethyl)pyrrole-2,5-dione |
| SMILES | CCCOc1cccc(NC2=C(c3ccccc3)C(=O)N(Cc3cccnc3)C2=O)c1 |
| InChI | InChI=1S/C25H23N3O3/c1-2-14-31-21-12-6-11-20(15-21)27-23-22(19-9-4-3-5-10-19)24(29)28(25(23)30)17-18-8-7-13-26-16-18/h3-13,15-16,27H,2,14,17H2,1H3 |
| InChIKey | HRDUFKBJVVTZKZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|