C23H16F3N3O2 — CID 110594411
3-phenyl-1-(pyridin-3-ylmethyl)-4-[3-(trifluoromethyl)anilino]pyrrole-2,5-dione (PubChem CID 110594411) has the molecular formula C23H16F3N3O2 and a molecular weight of 423.39 g/mol. Its IUPAC name is 3-phenyl-1-(pyridin-3-ylmethyl)-4-[3-(trifluoromethyl)anilino]pyrrole-2,5-dione.
| Compound Name | 3-phenyl-1-(pyridin-3-ylmethyl)-4-[3-(trifluoromethyl)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110594411 |
| Molecular Formula | C23H16F3N3O2 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 3-phenyl-1-(pyridin-3-ylmethyl)-4-[3-(trifluoromethyl)anilino]pyrrole-2,5-dione |
| SMILES | O=C1C(Nc2cccc(C(F)(F)F)c2)=C(c2ccccc2)C(=O)N1Cc1cccnc1 |
| InChI | InChI=1S/C23H16F3N3O2/c24-23(25,26)17-9-4-10-18(12-17)28-20-19(16-7-2-1-3-8-16)21(30)29(22(20)31)14-15-6-5-11-27-13-15/h1-13,28H,14H2 |
| InChIKey | AFIXFMMQBHFNSP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|