C16H17N5O4 — CID 44579397
2-(2-aminoethyl)-6-(2-aminoethylamino)-5-nitrobenzo[de]isoquinoline-1,3-dione (PubChem CID 44579397) has the molecular formula C16H17N5O4 and a molecular weight of 343.34 g/mol. Its IUPAC name is 2-(2-aminoethyl)-6-(2-aminoethylamino)-5-nitrobenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(2-aminoethyl)-6-(2-aminoethylamino)-5-nitrobenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 44579397 |
| Molecular Formula | C16H17N5O4 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 2-(2-aminoethyl)-6-(2-aminoethylamino)-5-nitrobenzo[de]isoquinoline-1,3-dione |
| SMILES | NCCNc1c([N+](=O)[O-])cc2c3c(cccc13)C(=O)N(CCN)C2=O |
| InChI | InChI=1S/C16H17N5O4/c17-4-6-19-14-9-2-1-3-10-13(9)11(8-12(14)21(24)25)16(23)20(7-5-18)15(10)22/h1-3,8,19H,4-7,17-18H2 |
| InChIKey | NTBAUICMVSVDEZ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 144.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|