C33H27ClN4O6 — CID 10326405
6-[3-[3-(6-chloro-5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)propyl-methylamino]propyl]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione (PubChem CID 10326405) has the molecular formula C33H27ClN4O6 and a molecular weight of 611.05 g/mol. Its IUPAC name is 6-[3-[3-(6-chloro-5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)propyl-methylamino]propyl]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione.
| Compound Name | 6-[3-[3-(6-chloro-5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)propyl-methylamino]propyl]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione |
|---|---|
| PubChem CID | 10326405 |
| Molecular Formula | C33H27ClN4O6 |
| Molecular Weight | 611.05 g/mol |
| Exact Mass | 610.16 |
| IUPAC Name | 6-[3-[3-(6-chloro-5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)propyl-methylamino]propyl]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione |
| SMILES | CN(CCCN1C(=O)c2cccc3c(Cl)c([N+](=O)[O-])cc(c23)C1=O)CCCN1C(=O)c2ccc3c4c(ccc(c24)C1=O)CC3 |
| InChI | InChI=1S/C33H27ClN4O6/c1-35(13-3-15-36-31(40)22-11-9-18-7-8-19-10-12-23(32(36)41)28(22)26(18)19)14-4-16-37-30(39)21-6-2-5-20-27(21)24(33(37)42)17-25(29(20)34)38(43)44/h2,5-6,9-12,17H,3-4,7-8,13-16H2,1H3 |
| InChIKey | QDBRMRZJYXYBND-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 121.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.05 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|