C33H27N5O8 — CID 10416433
6-[3-[3-(5,8-dinitro-1,3-dioxobenzo[de]isoquinolin-2-yl)propyl-methylamino]propyl]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione (PubChem CID 10416433) has the molecular formula C33H27N5O8 and a molecular weight of 621.61 g/mol. Its IUPAC name is 6-[3-[3-(5,8-dinitro-1,3-dioxobenzo[de]isoquinolin-2-yl)propyl-methylamino]propyl]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione.
| Compound Name | 6-[3-[3-(5,8-dinitro-1,3-dioxobenzo[de]isoquinolin-2-yl)propyl-methylamino]propyl]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione |
|---|---|
| PubChem CID | 10416433 |
| Molecular Formula | C33H27N5O8 |
| Molecular Weight | 621.61 g/mol |
| Exact Mass | 621.19 |
| IUPAC Name | 6-[3-[3-(5,8-dinitro-1,3-dioxobenzo[de]isoquinolin-2-yl)propyl-methylamino]propyl]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione |
| SMILES | CN(CCCN1C(=O)c2cc([N+](=O)[O-])cc3cc([N+](=O)[O-])cc(c23)C1=O)CCCN1C(=O)c2ccc3c4c(ccc(c24)C1=O)CC3 |
| InChI | InChI=1S/C33H27N5O8/c1-34(10-2-12-35-30(39)23-8-6-18-4-5-19-7-9-24(31(35)40)29(23)27(18)19)11-3-13-36-32(41)25-16-21(37(43)44)14-20-15-22(38(45)46)17-26(28(20)25)33(36)42/h6-9,14-17H,2-5,10-13H2,1H3 |
| InChIKey | MYPFMYFOYXLHDL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 164.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|