C22H18BrN3O4 — CID 126002765
6-(2-bromo-4,5-dimethylanilino)-2-ethyl-5-nitrobenzo[de]isoquinoline-1,3-dione (PubChem CID 126002765) has the molecular formula C22H18BrN3O4 and a molecular weight of 468.31 g/mol. Its IUPAC name is 6-(2-bromo-4,5-dimethylanilino)-2-ethyl-5-nitrobenzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-(2-bromo-4,5-dimethylanilino)-2-ethyl-5-nitrobenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 126002765 |
| Molecular Formula | C22H18BrN3O4 |
| Molecular Weight | 468.31 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | 6-(2-bromo-4,5-dimethylanilino)-2-ethyl-5-nitrobenzo[de]isoquinoline-1,3-dione |
| SMILES | CCN1C(=O)c2cccc3c(Nc4cc(C)c(C)cc4Br)c([N+](=O)[O-])cc(c23)C1=O |
| InChI | InChI=1S/C22H18BrN3O4/c1-4-25-21(27)14-7-5-6-13-19(14)15(22(25)28)10-18(26(29)30)20(13)24-17-9-12(3)11(2)8-16(17)23/h5-10,24H,4H2,1-3H3 |
| InChIKey | OHKDBHPNNAYBDD-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.31 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|