C19H9BrN4O7 — CID 3404806
N-(6-bromo-5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)-4-nitrobenzamide (PubChem CID 3404806) has the molecular formula C19H9BrN4O7 and a molecular weight of 485.21 g/mol. Its IUPAC name is N-(6-bromo-5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)-4-nitrobenzamide.
| Compound Name | N-(6-bromo-5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 3404806 |
| Molecular Formula | C19H9BrN4O7 |
| Molecular Weight | 485.21 g/mol |
| Exact Mass | 483.97 |
| IUPAC Name | N-(6-bromo-5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)-4-nitrobenzamide |
| SMILES | O=C(NN1C(=O)c2cccc3c(Br)c([N+](=O)[O-])cc(c23)C1=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H9BrN4O7/c20-16-11-2-1-3-12-15(11)13(8-14(16)24(30)31)19(27)22(18(12)26)21-17(25)9-4-6-10(7-5-9)23(28)29/h1-8H,(H,21,25) |
| InChIKey | FUPSEZIVONNUFW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.21 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|