C18H9N5O8 — CID 633202
2-(2,4-dinitroanilino)-6-nitrobenzo[de]isoquinoline-1,3-dione (PubChem CID 633202) has the molecular formula C18H9N5O8 and a molecular weight of 423.30 g/mol. Its IUPAC name is 2-(2,4-dinitroanilino)-6-nitrobenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(2,4-dinitroanilino)-6-nitrobenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 633202 |
| Molecular Formula | C18H9N5O8 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | 2-(2,4-dinitroanilino)-6-nitrobenzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3c([N+](=O)[O-])ccc(c23)C(=O)N1Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H9N5O8/c24-17-11-3-1-2-10-14(22(28)29)7-5-12(16(10)11)18(25)20(17)19-13-6-4-9(21(26)27)8-15(13)23(30)31/h1-8,19H |
| InChIKey | QPVKZNBKOLAJTA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 178.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|