C18H8Cl2N4O6 — CID 4185912
6,7-dichloro-2-(2,4-dinitroanilino)benzo[de]isoquinoline-1,3-dione (PubChem CID 4185912) has the molecular formula C18H8Cl2N4O6 and a molecular weight of 447.19 g/mol. Its IUPAC name is 6,7-dichloro-2-(2,4-dinitroanilino)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6,7-dichloro-2-(2,4-dinitroanilino)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 4185912 |
| Molecular Formula | C18H8Cl2N4O6 |
| Molecular Weight | 447.19 g/mol |
| Exact Mass | 445.98 |
| IUPAC Name | 6,7-dichloro-2-(2,4-dinitroanilino)benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2ccc(Cl)c3c(Cl)ccc(c23)C(=O)N1Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H8Cl2N4O6/c19-11-4-2-9-15-10(3-5-12(20)16(11)15)18(26)22(17(9)25)21-13-6-1-8(23(27)28)7-14(13)24(29)30/h1-7,21H |
| InChIKey | LWOLYBKSQPFDKV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.19 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|