C26H17ClN4O5 — CID 126003706
N-[4-[6-(2-chloroanilino)-5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl]phenyl]acetamide (PubChem CID 126003706) has the molecular formula C26H17ClN4O5 and a molecular weight of 500.90 g/mol. Its IUPAC name is N-[4-[6-(2-chloroanilino)-5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl]phenyl]acetamide.
| Compound Name | N-[4-[6-(2-chloroanilino)-5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 126003706 |
| Molecular Formula | C26H17ClN4O5 |
| Molecular Weight | 500.90 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | N-[4-[6-(2-chloroanilino)-5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)c3cccc4c(Nc5ccccc5Cl)c([N+](=O)[O-])cc(c34)C2=O)cc1 |
| InChI | InChI=1S/C26H17ClN4O5/c1-14(32)28-15-9-11-16(12-10-15)30-25(33)18-6-4-5-17-23(18)19(26(30)34)13-22(31(35)36)24(17)29-21-8-3-2-7-20(21)27/h2-13,29H,1H3,(H,28,32) |
| InChIKey | QZCXHGYWLNNVHA-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.90 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|