C15H7NO3 — CID 10776993
11-oxa-6-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,13,15-heptaene-10,12-dione (PubChem CID 10776993) has the molecular formula C15H7NO3 and a molecular weight of 249.23 g/mol. Its IUPAC name is 11-oxa-6-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,13,15-heptaene-10,12-dione.
| Compound Name | 11-oxa-6-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,13,15-heptaene-10,12-dione |
|---|---|
| PubChem CID | 10776993 |
| Molecular Formula | C15H7NO3 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 11-oxa-6-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,13,15-heptaene-10,12-dione |
| SMILES | O=C1OC(=O)c2cc3ncccc3c3cccc1c23 |
| InChI | InChI=1S/C15H7NO3/c17-14-10-4-1-3-9-8-5-2-6-16-12(8)7-11(13(9)10)15(18)19-14/h1-7H |
| InChIKey | WAYPBBVHXHAMLW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|