C18H11NO4 — CID 86100953
7-amino-8-phenoxy-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione (PubChem CID 86100953) has the molecular formula C18H11NO4 and a molecular weight of 305.29 g/mol. Its IUPAC name is 7-amino-8-phenoxy-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione.
| Compound Name | 7-amino-8-phenoxy-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione |
|---|---|
| PubChem CID | 86100953 |
| Molecular Formula | C18H11NO4 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 7-amino-8-phenoxy-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione |
| SMILES | Nc1cc2c3c(cccc3c1Oc1ccccc1)C(=O)OC2=O |
| InChI | InChI=1S/C18H11NO4/c19-14-9-13-15-11(16(14)22-10-5-2-1-3-6-10)7-4-8-12(15)17(20)23-18(13)21/h1-9H,19H2 |
| InChIKey | XXFPZONUJZDXRW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|