C16H8O6 — CID 88871922
5-(1,3-dioxo-2-benzofuran-5-yl)-2-formylbenzoic acid (PubChem CID 88871922) has the molecular formula C16H8O6 and a molecular weight of 296.23 g/mol. Its IUPAC name is 5-(1,3-dioxo-2-benzofuran-5-yl)-2-formylbenzoic acid.
| Compound Name | 5-(1,3-dioxo-2-benzofuran-5-yl)-2-formylbenzoic acid |
|---|---|
| PubChem CID | 88871922 |
| Molecular Formula | C16H8O6 |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 5-(1,3-dioxo-2-benzofuran-5-yl)-2-formylbenzoic acid |
| SMILES | O=Cc1ccc(-c2ccc3c(c2)C(=O)OC3=O)cc1C(=O)O |
| InChI | InChI=1S/C16H8O6/c17-7-10-2-1-8(5-12(10)14(18)19)9-3-4-11-13(6-9)16(21)22-15(11)20/h1-7H,(H,18,19) |
| InChIKey | JRRXTORIYUZAGW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|