5-(1,3-dioxo-2-benzofuran-5-yl)-2-formylbenzoic acid

C16H8O6 — CID 88871922

IUPAC5-(1,3-dioxo-2-benzofuran-5-yl)-2-formylbenzoic acid
SMILESO=Cc1ccc(-c2ccc3c(c2)C(=O)OC3=O)cc1C(=O)O
InChIInChI=1S/C16H8O6/c17-7-10-2-1-8(5-12(10)14(18)19)9-3-4-11-13(6-9)16(21)22-15(11)20/h1-7H,(H,18,19)
InChIKeyJRRXTORIYUZAGW-UHFFFAOYSA-N
MW296.23 g/mol
LogP2.17
Rot. Bonds3

About 5-(1,3-dioxo-2-benzofuran-5-yl)-2-formylbenzoic acid

5-(1,3-dioxo-2-benzofuran-5-yl)-2-formylbenzoic acid (PubChem CID 88871922) has the molecular formula C16H8O6 and a molecular weight of 296.23 g/mol. Its IUPAC name is 5-(1,3-dioxo-2-benzofuran-5-yl)-2-formylbenzoic acid.

Molecular Properties

Compound Name5-(1,3-dioxo-2-benzofuran-5-yl)-2-formylbenzoic acid
PubChem CID88871922
Molecular FormulaC16H8O6
Molecular Weight296.23 g/mol
Exact Mass296.03
IUPAC Name5-(1,3-dioxo-2-benzofuran-5-yl)-2-formylbenzoic acid
SMILESO=Cc1ccc(-c2ccc3c(c2)C(=O)OC3=O)cc1C(=O)O
InChIInChI=1S/C16H8O6/c17-7-10-2-1-8(5-12(10)14(18)19)9-3-4-11-13(6-9)16(21)22-15(11)20/h1-7H,(H,18,19)
InChIKeyJRRXTORIYUZAGW-UHFFFAOYSA-N
XLogP2.17
TPSA97.74 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.23
LogP ≤ 52.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 5-(1,3-dioxo-2-benzofuran-5-yl)-2-formylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(1,3-dioxo-2-benzofuran-5-yl)-2-formylbenzoic acid?
The IUPAC name of 5-(1,3-dioxo-2-benzofuran-5-yl)-2-formylbenzoic acid (CID 88871922) is 5-(1,3-dioxo-2-benzofuran-5-yl)-2-formylbenzoic acid.
What is the SMILES notation for 5-(1,3-dioxo-2-benzofuran-5-yl)-2-formylbenzoic acid?
The canonical SMILES for 5-(1,3-dioxo-2-benzofuran-5-yl)-2-formylbenzoic acid is O=Cc1ccc(-c2ccc3c(c2)C(=O)OC3=O)cc1C(=O)O.
What is the InChIKey of 5-(1,3-dioxo-2-benzofuran-5-yl)-2-formylbenzoic acid?
The InChIKey is JRRXTORIYUZAGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8O6/c17-7-10-2-1-8(5-12(10)14(18)19)9-3-4-11-13(6-9)16(21)22-15(11)20/h1-7H,(H,18,19).
What are the key properties of 5-(1,3-dioxo-2-benzofuran-5-yl)-2-formylbenzoic acid?
5-(1,3-dioxo-2-benzofuran-5-yl)-2-formylbenzoic acid has a molecular weight of 296.23 g/mol, XLogP of 2.17, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-dioxo-2-benzofuran-5-yl)-2-formylbenzoic acid is sourced from PubChem (CID 88871922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).