C13H17N4O7+ — CID 88694929
azane;diacetyl(diamino)azanium;1,3-dioxo-2-benzofuran-5-carboxylic acid (PubChem CID 88694929) has the molecular formula C13H17N4O7+ and a molecular weight of 341.30 g/mol. Its IUPAC name is azane;diacetyl(diamino)azanium;1,3-dioxo-2-benzofuran-5-carboxylic acid.
| Compound Name | azane;diacetyl(diamino)azanium;1,3-dioxo-2-benzofuran-5-carboxylic acid |
|---|---|
| PubChem CID | 88694929 |
| Molecular Formula | C13H17N4O7+ |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | azane;diacetyl(diamino)azanium;1,3-dioxo-2-benzofuran-5-carboxylic acid |
| SMILES | CC(=O)[N+](N)(N)C(C)=O.N.O=C(O)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C9H4O5.C4H10N3O2.H3N/c10-7(11)4-1-2-5-6(3-4)9(13)14-8(5)12;1-3(8)7(5,6)4(2)9;/h1-3H,(H,10,11);5-6H2,1-2H3;1H3/q;+1; |
| InChIKey | RGPHODYOKFOGLS-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 201.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|