C13H21N3O2 — CID 139942518
2-pyridin-2-ylethyl (2S)-2,6-diaminohexanoate (PubChem CID 139942518) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-pyridin-2-ylethyl (2S)-2,6-diaminohexanoate.
| Compound Name | 2-pyridin-2-ylethyl (2S)-2,6-diaminohexanoate |
|---|---|
| PubChem CID | 139942518 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 2-pyridin-2-ylethyl (2S)-2,6-diaminohexanoate |
| SMILES | NCCCC[C@H](N)C(=O)OCCc1ccccn1 |
| InChI | InChI=1S/C13H21N3O2/c14-8-3-1-6-12(15)13(17)18-10-7-11-5-2-4-9-16-11/h2,4-5,9,12H,1,3,6-8,10,14-15H2/t12-/m0/s1 |
| InChIKey | WFLCYJLGQHKQHH-LBPRGKRZSA-N |
| XLogP | 0.62 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|