C14H24N4O — CID 178172548
2,6-diamino-N-methyl-N-(2-pyridin-2-ylethyl)hexanamide (PubChem CID 178172548) has the molecular formula C14H24N4O and a molecular weight of 264.37 g/mol. Its IUPAC name is 2,6-diamino-N-methyl-N-(2-pyridin-2-ylethyl)hexanamide.
| Compound Name | 2,6-diamino-N-methyl-N-(2-pyridin-2-ylethyl)hexanamide |
|---|---|
| PubChem CID | 178172548 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 2,6-diamino-N-methyl-N-(2-pyridin-2-ylethyl)hexanamide |
| SMILES | CN(CCc1ccccn1)C(=O)C(N)CCCCN |
| InChI | InChI=1S/C14H24N4O/c1-18(11-8-12-6-3-5-10-17-12)14(19)13(16)7-2-4-9-15/h3,5-6,10,13H,2,4,7-9,11,15-16H2,1H3 |
| InChIKey | XVOVSHYLJZGEOH-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|