C23H21N3O4 — CID 17489902
N'-(4-methylphenyl)-N-[2-oxo-2-(2-phenoxyanilino)ethyl]oxamide (PubChem CID 17489902) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is N'-(4-methylphenyl)-N-[2-oxo-2-(2-phenoxyanilino)ethyl]oxamide.
| Compound Name | N'-(4-methylphenyl)-N-[2-oxo-2-(2-phenoxyanilino)ethyl]oxamide |
|---|---|
| PubChem CID | 17489902 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N'-(4-methylphenyl)-N-[2-oxo-2-(2-phenoxyanilino)ethyl]oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NCC(=O)Nc2ccccc2Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H21N3O4/c1-16-11-13-17(14-12-16)25-23(29)22(28)24-15-21(27)26-19-9-5-6-10-20(19)30-18-7-3-2-4-8-18/h2-14H,15H2,1H3,(H,24,28)(H,25,29)(H,26,27) |
| InChIKey | PZKHCZVTXDBAQD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|