C24H27N3O4 — CID 26195415
(2S)-2-(1,3-dioxoisoindol-2-yl)-N,4-dimethyl-N-[2-(4-methylanilino)-2-oxoethyl]pentanamide (PubChem CID 26195415) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-N,4-dimethyl-N-[2-(4-methylanilino)-2-oxoethyl]pentanamide.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-N,4-dimethyl-N-[2-(4-methylanilino)-2-oxoethyl]pentanamide |
|---|---|
| PubChem CID | 26195415 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-N,4-dimethyl-N-[2-(4-methylanilino)-2-oxoethyl]pentanamide |
| SMILES | Cc1ccc(NC(=O)CN(C)C(=O)[C@H](CC(C)C)N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C24H27N3O4/c1-15(2)13-20(27-22(29)18-7-5-6-8-19(18)23(27)30)24(31)26(4)14-21(28)25-17-11-9-16(3)10-12-17/h5-12,15,20H,13-14H2,1-4H3,(H,25,28)/t20-/m0/s1 |
| InChIKey | YMKKORONWXXRRL-FQEVSTJZSA-N |
| XLogP | 3.10 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|