C20H28N2O3 — CID 112817708
2-(1,3-dioxoisoindol-2-yl)-N-ethyl-4-methyl-N-(2-methylpropyl)pentanamide (PubChem CID 112817708) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-ethyl-4-methyl-N-(2-methylpropyl)pentanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-ethyl-4-methyl-N-(2-methylpropyl)pentanamide |
|---|---|
| PubChem CID | 112817708 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-ethyl-4-methyl-N-(2-methylpropyl)pentanamide |
| SMILES | CCN(CC(C)C)C(=O)C(CC(C)C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H28N2O3/c1-6-21(12-14(4)5)20(25)17(11-13(2)3)22-18(23)15-9-7-8-10-16(15)19(22)24/h7-10,13-14,17H,6,11-12H2,1-5H3 |
| InChIKey | HFMLYAWEHUOIRP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|