C25H28FN3O5 — CID 55767793
tert-butyl N-[5-[[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]amino]-2-fluorophenyl]carbamate (PubChem CID 55767793) has the molecular formula C25H28FN3O5 and a molecular weight of 469.51 g/mol. Its IUPAC name is tert-butyl N-[5-[[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]amino]-2-fluorophenyl]carbamate.
| Compound Name | tert-butyl N-[5-[[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]amino]-2-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 55767793 |
| Molecular Formula | C25H28FN3O5 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | tert-butyl N-[5-[[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]amino]-2-fluorophenyl]carbamate |
| SMILES | CC(C)CC(C(=O)Nc1ccc(F)c(NC(=O)OC(C)(C)C)c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H28FN3O5/c1-14(2)12-20(29-22(31)16-8-6-7-9-17(16)23(29)32)21(30)27-15-10-11-18(26)19(13-15)28-24(33)34-25(3,4)5/h6-11,13-14,20H,12H2,1-5H3,(H,27,30)(H,28,33) |
| InChIKey | IKBAXEKGFGPDST-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|