C22H23N3O5 — CID 108755491
ethyl 2-[[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]amino]pyridine-4-carboxylate (PubChem CID 108755491) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is ethyl 2-[[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]amino]pyridine-4-carboxylate.
| Compound Name | ethyl 2-[[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]amino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 108755491 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | ethyl 2-[[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]amino]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc(NC(=O)C(CC(C)C)N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C22H23N3O5/c1-4-30-22(29)14-9-10-23-18(12-14)24-19(26)17(11-13(2)3)25-20(27)15-7-5-6-8-16(15)21(25)28/h5-10,12-13,17H,4,11H2,1-3H3,(H,23,24,26) |
| InChIKey | GFWAVASJBJTNFB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|