C22H22N2O5 — CID 19169182
2-methylpropyl 4-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]benzoate (PubChem CID 19169182) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is 2-methylpropyl 4-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]benzoate.
| Compound Name | 2-methylpropyl 4-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]benzoate |
|---|---|
| PubChem CID | 19169182 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 2-methylpropyl 4-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]benzoate |
| SMILES | CC(C)COC(=O)c1ccc(NC(=O)C(C)N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C22H22N2O5/c1-13(2)12-29-22(28)15-8-10-16(11-9-15)23-19(25)14(3)24-20(26)17-6-4-5-7-18(17)21(24)27/h4-11,13-14H,12H2,1-3H3,(H,23,25) |
| InChIKey | QKVJSRHLMSVNMB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|