C18H13N2O5- — CID 4523065
4-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]benzoate (PubChem CID 4523065) has the molecular formula C18H13N2O5- and a molecular weight of 337.31 g/mol. Its IUPAC name is 4-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]benzoate.
| Compound Name | 4-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]benzoate |
|---|---|
| PubChem CID | 4523065 |
| Molecular Formula | C18H13N2O5- |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 4-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]benzoate |
| SMILES | CC(C(=O)Nc1ccc(C(=O)[O-])cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H14N2O5/c1-10(15(21)19-12-8-6-11(7-9-12)18(24)25)20-16(22)13-4-2-3-5-14(13)17(20)23/h2-10H,1H3,(H,19,21)(H,24,25)/p-1 |
| InChIKey | GYRAAKULGNGUBH-UHFFFAOYSA-M |
| XLogP | 0.67 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|