C19H19N3O5S — CID 8917851
(2S)-N-[4-(dimethylsulfamoyl)phenyl]-2-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 8917851) has the molecular formula C19H19N3O5S and a molecular weight of 401.44 g/mol. Its IUPAC name is (2S)-N-[4-(dimethylsulfamoyl)phenyl]-2-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | (2S)-N-[4-(dimethylsulfamoyl)phenyl]-2-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 8917851 |
| Molecular Formula | C19H19N3O5S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | (2S)-N-[4-(dimethylsulfamoyl)phenyl]-2-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(S(=O)(=O)N(C)C)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H19N3O5S/c1-12(22-18(24)15-6-4-5-7-16(15)19(22)25)17(23)20-13-8-10-14(11-9-13)28(26,27)21(2)3/h4-12H,1-3H3,(H,20,23)/t12-/m0/s1 |
| InChIKey | KJHDAKAHHCBJED-LBPRGKRZSA-N |
| XLogP | 1.56 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|