C21H20N6O3S — CID 42930289
2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanyl-N-[3-(1-methyltetrazol-5-yl)phenyl]butanamide (PubChem CID 42930289) has the molecular formula C21H20N6O3S and a molecular weight of 436.50 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanyl-N-[3-(1-methyltetrazol-5-yl)phenyl]butanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanyl-N-[3-(1-methyltetrazol-5-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 42930289 |
| Molecular Formula | C21H20N6O3S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanyl-N-[3-(1-methyltetrazol-5-yl)phenyl]butanamide |
| SMILES | CSCCC(C(=O)Nc1cccc(-c2nnnn2C)c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H20N6O3S/c1-26-18(23-24-25-26)13-6-5-7-14(12-13)22-19(28)17(10-11-31-2)27-20(29)15-8-3-4-9-16(15)21(27)30/h3-9,12,17H,10-11H2,1-2H3,(H,22,28) |
| InChIKey | QVHHTFTXUXWQBS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|