C19H16N6O3 — CID 46683955
2-(1,3-dioxoisoindol-2-yl)-N-[3-(1-methyltetrazol-5-yl)phenyl]propanamide (PubChem CID 46683955) has the molecular formula C19H16N6O3 and a molecular weight of 376.38 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[3-(1-methyltetrazol-5-yl)phenyl]propanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[3-(1-methyltetrazol-5-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 46683955 |
| Molecular Formula | C19H16N6O3 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[3-(1-methyltetrazol-5-yl)phenyl]propanamide |
| SMILES | CC(C(=O)Nc1cccc(-c2nnnn2C)c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H16N6O3/c1-11(25-18(27)14-8-3-4-9-15(14)19(25)28)17(26)20-13-7-5-6-12(10-13)16-21-22-23-24(16)2/h3-11H,1-2H3,(H,20,26) |
| InChIKey | LKBVQQOFCVXJDP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|