C14H15NO5 — CID 8872522
(5-methyl-1,2-oxazol-3-yl)methyl 3,5-dimethoxybenzoate (PubChem CID 8872522) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is (5-methyl-1,2-oxazol-3-yl)methyl 3,5-dimethoxybenzoate.
| Compound Name | (5-methyl-1,2-oxazol-3-yl)methyl 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 8872522 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | (5-methyl-1,2-oxazol-3-yl)methyl 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)OCc2cc(C)on2)c1 |
| InChI | InChI=1S/C14H15NO5/c1-9-4-11(15-20-9)8-19-14(16)10-5-12(17-2)7-13(6-10)18-3/h4-7H,8H2,1-3H3 |
| InChIKey | QOWDCTZOBGEMEA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |