C20H18ClN3O3S — CID 2650572
[2-[2-(2,5-dimethylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 6-chloropyridine-3-carboxylate (PubChem CID 2650572) has the molecular formula C20H18ClN3O3S and a molecular weight of 415.90 g/mol. Its IUPAC name is [2-[2-(2,5-dimethylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 6-chloropyridine-3-carboxylate.
| Compound Name | [2-[2-(2,5-dimethylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 2650572 |
| Molecular Formula | C20H18ClN3O3S |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | [2-[2-(2,5-dimethylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 6-chloropyridine-3-carboxylate |
| SMILES | Cc1ccc(C)c(NC(=O)Cc2nc(COC(=O)c3ccc(Cl)nc3)cs2)c1 |
| InChI | InChI=1S/C20H18ClN3O3S/c1-12-3-4-13(2)16(7-12)24-18(25)8-19-23-15(11-28-19)10-27-20(26)14-5-6-17(21)22-9-14/h3-7,9,11H,8,10H2,1-2H3,(H,24,25) |
| InChIKey | OBMJSKHUFRVSRK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|