C22H18FNO5 — CID 8848903
methyl 4-[(E)-3-[[5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methoxy]-3-oxoprop-1-enyl]benzoate (PubChem CID 8848903) has the molecular formula C22H18FNO5 and a molecular weight of 395.39 g/mol. Its IUPAC name is methyl 4-[(E)-3-[[5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methoxy]-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-3-[[5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methoxy]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 8848903 |
| Molecular Formula | C22H18FNO5 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | methyl 4-[(E)-3-[[5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methoxy]-3-oxoprop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C/C(=O)OCc2noc(-c3ccc(F)cc3)c2C)cc1 |
| InChI | InChI=1S/C22H18FNO5/c1-14-19(24-29-21(14)16-8-10-18(23)11-9-16)13-28-20(25)12-5-15-3-6-17(7-4-15)22(26)27-2/h3-12H,13H2,1-2H3/b12-5+ |
| InChIKey | RVHJCAMRNYKHPP-LFYBBSHMSA-N |
| XLogP | 4.33 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|