C20H20FN3O5 — CID 8848845
[5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate (PubChem CID 8848845) has the molecular formula C20H20FN3O5 and a molecular weight of 401.39 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate.
| Compound Name | [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
|---|---|
| PubChem CID | 8848845 |
| Molecular Formula | C20H20FN3O5 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
| SMILES | Cc1c(COC(=O)CN2C(=O)NC3(CCCC3)C2=O)noc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H20FN3O5/c1-12-15(23-29-17(12)13-4-6-14(21)7-5-13)11-28-16(25)10-24-18(26)20(22-19(24)27)8-2-3-9-20/h4-7H,2-3,8-11H2,1H3,(H,22,27) |
| InChIKey | BBOBTGOXNCQCAF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|