C20H17N3O5S — CID 55355936
(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl 2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate (PubChem CID 55355936) has the molecular formula C20H17N3O5S and a molecular weight of 411.44 g/mol. Its IUPAC name is (3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl 2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate.
| Compound Name | (3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl 2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate |
|---|---|
| PubChem CID | 55355936 |
| Molecular Formula | C20H17N3O5S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | (3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl 2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate |
| SMILES | CC(C)C(C(=O)OCc1nc(-c2cccs2)no1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H17N3O5S/c1-11(2)16(23-18(24)12-6-3-4-7-13(12)19(23)25)20(26)27-10-15-21-17(22-28-15)14-8-5-9-29-14/h3-9,11,16H,10H2,1-2H3 |
| InChIKey | FINLXEAYZKISLY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|