C27H20ClN3O7 — CID 2394651
[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 3-[(1,3-dioxoisoindol-2-yl)methyl]-4,5-dimethoxybenzoate (PubChem CID 2394651) has the molecular formula C27H20ClN3O7 and a molecular weight of 533.92 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 3-[(1,3-dioxoisoindol-2-yl)methyl]-4,5-dimethoxybenzoate.
| Compound Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 3-[(1,3-dioxoisoindol-2-yl)methyl]-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 2394651 |
| Molecular Formula | C27H20ClN3O7 |
| Molecular Weight | 533.92 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 3-[(1,3-dioxoisoindol-2-yl)methyl]-4,5-dimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCc2nnc(-c3ccc(Cl)cc3)o2)cc(CN2C(=O)c3ccccc3C2=O)c1OC |
| InChI | InChI=1S/C27H20ClN3O7/c1-35-21-12-16(27(34)37-14-22-29-30-24(38-22)15-7-9-18(28)10-8-15)11-17(23(21)36-2)13-31-25(32)19-5-3-4-6-20(19)26(31)33/h3-12H,13-14H2,1-2H3 |
| InChIKey | QBZADHYOWJGYOX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 121.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.92 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|