About benzyl benzoate;pyrrolidin-2-one
benzyl benzoate;pyrrolidin-2-one (PubChem CID 159513468) has the molecular formula C18H19NO3
and a molecular weight of 297.35 g/mol. Its IUPAC name is benzyl benzoate;pyrrolidin-2-one.
Molecular Properties
| Compound Name | benzyl benzoate;pyrrolidin-2-one |
| PubChem CID | 159513468 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | benzyl benzoate;pyrrolidin-2-one |
| SMILES | O=C(OCc1ccccc1)c1ccccc1.O=C1CCCN1 |
| InChI | InChI=1S/C14H12O2.C4H7NO/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12;6-4-2-1-3-5-4/h1-10H,11H2;1-3H2,(H,5,6) |
| InChIKey | MAWVTLCRXNEAAL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl benzoate;pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl benzoate;pyrrolidin-2-one?
The IUPAC name of benzyl benzoate;pyrrolidin-2-one (CID 159513468) is benzyl benzoate;pyrrolidin-2-one.
What is the SMILES notation for benzyl benzoate;pyrrolidin-2-one?
The canonical SMILES for benzyl benzoate;pyrrolidin-2-one is O=C(OCc1ccccc1)c1ccccc1.O=C1CCCN1.
What is the InChIKey of benzyl benzoate;pyrrolidin-2-one?
The InChIKey is MAWVTLCRXNEAAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O2.C4H7NO/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12;6-4-2-1-3-5-4/h1-10H,11H2;1-3H2,(H,5,6).
What are the key properties of benzyl benzoate;pyrrolidin-2-one?
benzyl benzoate;pyrrolidin-2-one has a molecular weight of 297.35 g/mol, XLogP of 2.94, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl benzoate;pyrrolidin-2-one is sourced from PubChem (CID 159513468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).