About benzyl 2-bromoacetate;benzyl 2-(2-oxopiperidin-1-yl)acetate;piperidin-2-one
benzyl 2-bromoacetate;benzyl 2-(2-oxopiperidin-1-yl)acetate;piperidin-2-one (PubChem CID 157206751) has the molecular formula C28H35BrN2O6
and a molecular weight of 575.50 g/mol. Its IUPAC name is benzyl 2-bromoacetate;benzyl 2-(2-oxopiperidin-1-yl)acetate;piperidin-2-one.
Molecular Properties
| Compound Name | benzyl 2-bromoacetate;benzyl 2-(2-oxopiperidin-1-yl)acetate;piperidin-2-one |
| PubChem CID | 157206751 |
| Molecular Formula | C28H35BrN2O6 |
| Molecular Weight | 575.50 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | benzyl 2-bromoacetate;benzyl 2-(2-oxopiperidin-1-yl)acetate;piperidin-2-one |
| SMILES | O=C(CBr)OCc1ccccc1.O=C(CN1CCCCC1=O)OCc1ccccc1.O=C1CCCCN1 |
| InChI | InChI=1S/C14H17NO3.C9H9BrO2.C5H9NO/c16-13-8-4-5-9-15(13)10-14(17)18-11-12-6-2-1-3-7-12;10-6-9(11)12-7-8-4-2-1-3-5-8;7-5-3-1-2-4-6-5/h1-3,6-7H,4-5,8-11H2;1-5H,6-7H2;1-4H2,(H,6,7) |
| InChIKey | ARLFOZCXCWDMCD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 575.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-bromoacetate;benzyl 2-(2-oxopiperidin-1-yl)acetate;piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-bromoacetate;benzyl 2-(2-oxopiperidin-1-yl)acetate;piperidin-2-one?
The IUPAC name of benzyl 2-bromoacetate;benzyl 2-(2-oxopiperidin-1-yl)acetate;piperidin-2-one (CID 157206751) is benzyl 2-bromoacetate;benzyl 2-(2-oxopiperidin-1-yl)acetate;piperidin-2-one.
What is the SMILES notation for benzyl 2-bromoacetate;benzyl 2-(2-oxopiperidin-1-yl)acetate;piperidin-2-one?
The canonical SMILES for benzyl 2-bromoacetate;benzyl 2-(2-oxopiperidin-1-yl)acetate;piperidin-2-one is O=C(CBr)OCc1ccccc1.O=C(CN1CCCCC1=O)OCc1ccccc1.O=C1CCCCN1.
What is the InChIKey of benzyl 2-bromoacetate;benzyl 2-(2-oxopiperidin-1-yl)acetate;piperidin-2-one?
The InChIKey is ARLFOZCXCWDMCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3.C9H9BrO2.C5H9NO/c16-13-8-4-5-9-15(13)10-14(17)18-11-12-6-2-1-3-7-12;10-6-9(11)12-7-8-4-2-1-3-5-8;7-5-3-1-2-4-6-5/h1-3,6-7H,4-5,8-11H2;1-5H,6-7H2;1-4H2,(H,6,7).
What are the key properties of benzyl 2-bromoacetate;benzyl 2-(2-oxopiperidin-1-yl)acetate;piperidin-2-one?
benzyl 2-bromoacetate;benzyl 2-(2-oxopiperidin-1-yl)acetate;piperidin-2-one has a molecular weight of 575.50 g/mol, XLogP of 4.15, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-bromoacetate;benzyl 2-(2-oxopiperidin-1-yl)acetate;piperidin-2-one is sourced from PubChem (CID 157206751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).