C18H17NO3S — CID 24633772
(4-phenylphenyl)methyl 2-(4-oxo-1,3-thiazolidin-3-yl)acetate (PubChem CID 24633772) has the molecular formula C18H17NO3S and a molecular weight of 327.40 g/mol. Its IUPAC name is (4-phenylphenyl)methyl 2-(4-oxo-1,3-thiazolidin-3-yl)acetate.
| Compound Name | (4-phenylphenyl)methyl 2-(4-oxo-1,3-thiazolidin-3-yl)acetate |
|---|---|
| PubChem CID | 24633772 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (4-phenylphenyl)methyl 2-(4-oxo-1,3-thiazolidin-3-yl)acetate |
| SMILES | O=C(CN1CSCC1=O)OCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H17NO3S/c20-17-12-23-13-19(17)10-18(21)22-11-14-6-8-16(9-7-14)15-4-2-1-3-5-15/h1-9H,10-13H2 |
| InChIKey | NMKXBQANYZQYRT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |