C22H26N2O3 — CID 174402054
benzyl 2-[(3S)-3-amino-2-oxo-3-(2-phenylethyl)piperidin-1-yl]acetate (PubChem CID 174402054) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is benzyl 2-[(3S)-3-amino-2-oxo-3-(2-phenylethyl)piperidin-1-yl]acetate.
| Compound Name | benzyl 2-[(3S)-3-amino-2-oxo-3-(2-phenylethyl)piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 174402054 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | benzyl 2-[(3S)-3-amino-2-oxo-3-(2-phenylethyl)piperidin-1-yl]acetate |
| SMILES | N[C@@]1(CCc2ccccc2)CCCN(CC(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C22H26N2O3/c23-22(14-12-18-8-3-1-4-9-18)13-7-15-24(21(22)26)16-20(25)27-17-19-10-5-2-6-11-19/h1-6,8-11H,7,12-17,23H2/t22-/m1/s1 |
| InChIKey | ZKAHPIDBGJZBAW-JOCHJYFZSA-N |
| XLogP | 2.68 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |