About benzyl 2-(3-oxomorpholin-4-yl)acetate;2-(3-oxomorpholin-4-yl)acetic acid
benzyl 2-(3-oxomorpholin-4-yl)acetate;2-(3-oxomorpholin-4-yl)acetic acid (PubChem CID 158991156) has the molecular formula C19H24N2O8
and a molecular weight of 408.41 g/mol. Its IUPAC name is benzyl 2-(3-oxomorpholin-4-yl)acetate;2-(3-oxomorpholin-4-yl)acetic acid.
Molecular Properties
| Compound Name | benzyl 2-(3-oxomorpholin-4-yl)acetate;2-(3-oxomorpholin-4-yl)acetic acid |
| PubChem CID | 158991156 |
| Molecular Formula | C19H24N2O8 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | benzyl 2-(3-oxomorpholin-4-yl)acetate;2-(3-oxomorpholin-4-yl)acetic acid |
| SMILES | O=C(CN1CCOCC1=O)OCc1ccccc1.O=C(O)CN1CCOCC1=O |
| InChI | InChI=1S/C13H15NO4.C6H9NO4/c15-12-10-17-7-6-14(12)8-13(16)18-9-11-4-2-1-3-5-11;8-5-4-11-2-1-7(5)3-6(9)10/h1-5H,6-10H2;1-4H2,(H,9,10) |
| InChIKey | JQEGLRRTTXFIFC-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze benzyl 2-(3-oxomorpholin-4-yl)acetate;2-(3-oxomorpholin-4-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-(3-oxomorpholin-4-yl)acetate;2-(3-oxomorpholin-4-yl)acetic acid?
The IUPAC name of benzyl 2-(3-oxomorpholin-4-yl)acetate;2-(3-oxomorpholin-4-yl)acetic acid (CID 158991156) is benzyl 2-(3-oxomorpholin-4-yl)acetate;2-(3-oxomorpholin-4-yl)acetic acid.
What is the SMILES notation for benzyl 2-(3-oxomorpholin-4-yl)acetate;2-(3-oxomorpholin-4-yl)acetic acid?
The canonical SMILES for benzyl 2-(3-oxomorpholin-4-yl)acetate;2-(3-oxomorpholin-4-yl)acetic acid is O=C(CN1CCOCC1=O)OCc1ccccc1.O=C(O)CN1CCOCC1=O.
What is the InChIKey of benzyl 2-(3-oxomorpholin-4-yl)acetate;2-(3-oxomorpholin-4-yl)acetic acid?
The InChIKey is JQEGLRRTTXFIFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO4.C6H9NO4/c15-12-10-17-7-6-14(12)8-13(16)18-9-11-4-2-1-3-5-11;8-5-4-11-2-1-7(5)3-6(9)10/h1-5H,6-10H2;1-4H2,(H,9,10).
What are the key properties of benzyl 2-(3-oxomorpholin-4-yl)acetate;2-(3-oxomorpholin-4-yl)acetic acid?
benzyl 2-(3-oxomorpholin-4-yl)acetate;2-(3-oxomorpholin-4-yl)acetic acid has a molecular weight of 408.41 g/mol, XLogP of -0.48, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-(3-oxomorpholin-4-yl)acetate;2-(3-oxomorpholin-4-yl)acetic acid is sourced from PubChem (CID 158991156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).