C21H23NO5 — CID 100949439
benzyl 2-[(3R)-3-hydroxy-3-[(S)-hydroxy(phenyl)methyl]-2-oxopiperidin-1-yl]acetate (PubChem CID 100949439) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is benzyl 2-[(3R)-3-hydroxy-3-[(S)-hydroxy(phenyl)methyl]-2-oxopiperidin-1-yl]acetate.
| Compound Name | benzyl 2-[(3R)-3-hydroxy-3-[(S)-hydroxy(phenyl)methyl]-2-oxopiperidin-1-yl]acetate |
|---|---|
| PubChem CID | 100949439 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | benzyl 2-[(3R)-3-hydroxy-3-[(S)-hydroxy(phenyl)methyl]-2-oxopiperidin-1-yl]acetate |
| SMILES | O=C(CN1CCC[C@@](O)([C@@H](O)c2ccccc2)C1=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H23NO5/c23-18(27-15-16-8-3-1-4-9-16)14-22-13-7-12-21(26,20(22)25)19(24)17-10-5-2-6-11-17/h1-6,8-11,19,24,26H,7,12-15H2/t19-,21+/m0/s1 |
| InChIKey | HYQJKJBJMAUZCW-PZJWPPBQSA-N |
| XLogP | 1.82 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |