C18H25NO5 — CID 100949440
tert-butyl 2-[(3R)-3-hydroxy-3-[(S)-hydroxy(phenyl)methyl]-2-oxopiperidin-1-yl]acetate (PubChem CID 100949440) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is tert-butyl 2-[(3R)-3-hydroxy-3-[(S)-hydroxy(phenyl)methyl]-2-oxopiperidin-1-yl]acetate.
| Compound Name | tert-butyl 2-[(3R)-3-hydroxy-3-[(S)-hydroxy(phenyl)methyl]-2-oxopiperidin-1-yl]acetate |
|---|---|
| PubChem CID | 100949440 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | tert-butyl 2-[(3R)-3-hydroxy-3-[(S)-hydroxy(phenyl)methyl]-2-oxopiperidin-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCC[C@@](O)([C@@H](O)c2ccccc2)C1=O |
| InChI | InChI=1S/C18H25NO5/c1-17(2,3)24-14(20)12-19-11-7-10-18(23,16(19)22)15(21)13-8-5-4-6-9-13/h4-6,8-9,15,21,23H,7,10-12H2,1-3H3/t15-,18+/m0/s1 |
| InChIKey | KXXXBBJTULNDAB-MAUKXSAKSA-N |
| XLogP | 1.42 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |