C18H23NO3 — CID 100949437
tert-butyl 2-[(3E)-3-benzylidene-2-oxopiperidin-1-yl]acetate (PubChem CID 100949437) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is tert-butyl 2-[(3E)-3-benzylidene-2-oxopiperidin-1-yl]acetate.
| Compound Name | tert-butyl 2-[(3E)-3-benzylidene-2-oxopiperidin-1-yl]acetate |
|---|---|
| PubChem CID | 100949437 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | tert-butyl 2-[(3E)-3-benzylidene-2-oxopiperidin-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCC/C(=C\c2ccccc2)C1=O |
| InChI | InChI=1S/C18H23NO3/c1-18(2,3)22-16(20)13-19-11-7-10-15(17(19)21)12-14-8-5-4-6-9-14/h4-6,8-9,12H,7,10-11,13H2,1-3H3/b15-12+ |
| InChIKey | ZYBLRWMKDGDSCR-NTCAYCPXSA-N |
| XLogP | 3.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|