C18H22O4 — CID 142413075
tert-butyl 2-(5-benzylidene-2-oxooxan-3-yl)acetate (PubChem CID 142413075) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is tert-butyl 2-(5-benzylidene-2-oxooxan-3-yl)acetate.
| Compound Name | tert-butyl 2-(5-benzylidene-2-oxooxan-3-yl)acetate |
|---|---|
| PubChem CID | 142413075 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | tert-butyl 2-(5-benzylidene-2-oxooxan-3-yl)acetate |
| SMILES | CC(C)(C)OC(=O)CC1CC(=Cc2ccccc2)COC1=O |
| InChI | InChI=1S/C18H22O4/c1-18(2,3)22-16(19)11-15-10-14(12-21-17(15)20)9-13-7-5-4-6-8-13/h4-9,15H,10-12H2,1-3H3 |
| InChIKey | BUXAYALPCZNSSP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |