C24H34O7 — CID 158336207
tert-butyl 2-[(3R,8S,9S,10S)-10-methyl-2-oxo-9-phenoxy-8-prop-2-enoxy-1,6-dioxecan-3-yl]acetate (PubChem CID 158336207) has the molecular formula C24H34O7 and a molecular weight of 434.53 g/mol. Its IUPAC name is tert-butyl 2-[(3R,8S,9S,10S)-10-methyl-2-oxo-9-phenoxy-8-prop-2-enoxy-1,6-dioxecan-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3R,8S,9S,10S)-10-methyl-2-oxo-9-phenoxy-8-prop-2-enoxy-1,6-dioxecan-3-yl]acetate |
|---|---|
| PubChem CID | 158336207 |
| Molecular Formula | C24H34O7 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | tert-butyl 2-[(3R,8S,9S,10S)-10-methyl-2-oxo-9-phenoxy-8-prop-2-enoxy-1,6-dioxecan-3-yl]acetate |
| SMILES | C=CCO[C@H]1COCC[C@H](CC(=O)OC(C)(C)C)C(=O)O[C@@H](C)[C@@H]1Oc1ccccc1 |
| InChI | InChI=1S/C24H34O7/c1-6-13-28-20-16-27-14-12-18(15-21(25)31-24(3,4)5)23(26)29-17(2)22(20)30-19-10-8-7-9-11-19/h6-11,17-18,20,22H,1,12-16H2,2-5H3/t17-,18+,20-,22-/m0/s1 |
| InChIKey | GQPNIXSWYCLPHF-TWWGPRNNSA-N |
| XLogP | 3.71 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|