C17H20N4O3 — CID 27910056
(4-aminoquinazolin-2-yl)methyl 2-(2-oxoazepan-1-yl)acetate (PubChem CID 27910056) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is (4-aminoquinazolin-2-yl)methyl 2-(2-oxoazepan-1-yl)acetate.
| Compound Name | (4-aminoquinazolin-2-yl)methyl 2-(2-oxoazepan-1-yl)acetate |
|---|---|
| PubChem CID | 27910056 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (4-aminoquinazolin-2-yl)methyl 2-(2-oxoazepan-1-yl)acetate |
| SMILES | Nc1nc(COC(=O)CN2CCCCCC2=O)nc2ccccc12 |
| InChI | InChI=1S/C17H20N4O3/c18-17-12-6-3-4-7-13(12)19-14(20-17)11-24-16(23)10-21-9-5-1-2-8-15(21)22/h3-4,6-7H,1-2,5,8-11H2,(H2,18,19,20) |
| InChIKey | HKWRLLMTYCWFON-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |