C19H20N4O4 — CID 7727733
[3-(cyanomethyl)-4-oxoquinazolin-2-yl]methyl 2-(2-oxoazepan-1-yl)acetate (PubChem CID 7727733) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is [3-(cyanomethyl)-4-oxoquinazolin-2-yl]methyl 2-(2-oxoazepan-1-yl)acetate.
| Compound Name | [3-(cyanomethyl)-4-oxoquinazolin-2-yl]methyl 2-(2-oxoazepan-1-yl)acetate |
|---|---|
| PubChem CID | 7727733 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | [3-(cyanomethyl)-4-oxoquinazolin-2-yl]methyl 2-(2-oxoazepan-1-yl)acetate |
| SMILES | N#CCn1c(COC(=O)CN2CCCCCC2=O)nc2ccccc2c1=O |
| InChI | InChI=1S/C19H20N4O4/c20-9-11-23-16(21-15-7-4-3-6-14(15)19(23)26)13-27-18(25)12-22-10-5-1-2-8-17(22)24/h3-4,6-7H,1-2,5,8,10-13H2 |
| InChIKey | BKRDBOYGWMDZET-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 105.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |