C14H13N3O4 — CID 8018822
[3-(cyanomethyl)-4-oxoquinazolin-2-yl]methyl 2-methoxyacetate (PubChem CID 8018822) has the molecular formula C14H13N3O4 and a molecular weight of 287.28 g/mol. Its IUPAC name is [3-(cyanomethyl)-4-oxoquinazolin-2-yl]methyl 2-methoxyacetate.
| Compound Name | [3-(cyanomethyl)-4-oxoquinazolin-2-yl]methyl 2-methoxyacetate |
|---|---|
| PubChem CID | 8018822 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | [3-(cyanomethyl)-4-oxoquinazolin-2-yl]methyl 2-methoxyacetate |
| SMILES | COCC(=O)OCc1nc2ccccc2c(=O)n1CC#N |
| InChI | InChI=1S/C14H13N3O4/c1-20-9-13(18)21-8-12-16-11-5-3-2-4-10(11)14(19)17(12)7-6-15/h2-5H,7-9H2,1H3 |
| InChIKey | VEHSYLNRHYACBS-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 94.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |