C20H17N3O4S — CID 8014243
[3-(cyanomethyl)-4-oxoquinazolin-2-yl]methyl 2-methoxy-4-methylsulfanylbenzoate (PubChem CID 8014243) has the molecular formula C20H17N3O4S and a molecular weight of 395.44 g/mol. Its IUPAC name is [3-(cyanomethyl)-4-oxoquinazolin-2-yl]methyl 2-methoxy-4-methylsulfanylbenzoate.
| Compound Name | [3-(cyanomethyl)-4-oxoquinazolin-2-yl]methyl 2-methoxy-4-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 8014243 |
| Molecular Formula | C20H17N3O4S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | [3-(cyanomethyl)-4-oxoquinazolin-2-yl]methyl 2-methoxy-4-methylsulfanylbenzoate |
| SMILES | COc1cc(SC)ccc1C(=O)OCc1nc2ccccc2c(=O)n1CC#N |
| InChI | InChI=1S/C20H17N3O4S/c1-26-17-11-13(28-2)7-8-15(17)20(25)27-12-18-22-16-6-4-3-5-14(16)19(24)23(18)10-9-21/h3-8,11H,10,12H2,1-2H3 |
| InChIKey | SPKFREJGHCYNHO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 94.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |