C23H19N3O5 — CID 7961094
[3-(cyanomethyl)-4-oxoquinazolin-2-yl]methyl 3-(ethoxymethyl)-1-benzofuran-2-carboxylate (PubChem CID 7961094) has the molecular formula C23H19N3O5 and a molecular weight of 417.42 g/mol. Its IUPAC name is [3-(cyanomethyl)-4-oxoquinazolin-2-yl]methyl 3-(ethoxymethyl)-1-benzofuran-2-carboxylate.
| Compound Name | [3-(cyanomethyl)-4-oxoquinazolin-2-yl]methyl 3-(ethoxymethyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 7961094 |
| Molecular Formula | C23H19N3O5 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | [3-(cyanomethyl)-4-oxoquinazolin-2-yl]methyl 3-(ethoxymethyl)-1-benzofuran-2-carboxylate |
| SMILES | CCOCc1c(C(=O)OCc2nc3ccccc3c(=O)n2CC#N)oc2ccccc12 |
| InChI | InChI=1S/C23H19N3O5/c1-2-29-13-17-15-7-4-6-10-19(15)31-21(17)23(28)30-14-20-25-18-9-5-3-8-16(18)22(27)26(20)12-11-24/h3-10H,2,12-14H2,1H3 |
| InChIKey | WWFJJKXTLQDZAE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 107.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |