C18H11ClN4O5 — CID 7851954
[3-(cyanomethyl)-4-oxoquinazolin-2-yl]methyl 4-chloro-2-nitrobenzoate (PubChem CID 7851954) has the molecular formula C18H11ClN4O5 and a molecular weight of 398.76 g/mol. Its IUPAC name is [3-(cyanomethyl)-4-oxoquinazolin-2-yl]methyl 4-chloro-2-nitrobenzoate.
| Compound Name | [3-(cyanomethyl)-4-oxoquinazolin-2-yl]methyl 4-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 7851954 |
| Molecular Formula | C18H11ClN4O5 |
| Molecular Weight | 398.76 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | [3-(cyanomethyl)-4-oxoquinazolin-2-yl]methyl 4-chloro-2-nitrobenzoate |
| SMILES | N#CCn1c(COC(=O)c2ccc(Cl)cc2[N+](=O)[O-])nc2ccccc2c1=O |
| InChI | InChI=1S/C18H11ClN4O5/c19-11-5-6-13(15(9-11)23(26)27)18(25)28-10-16-21-14-4-2-1-3-12(14)17(24)22(16)8-7-20/h1-6,9H,8,10H2 |
| InChIKey | FCRGAMVKIYCEPR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 128.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.76 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|