C22H17N5O4 — CID 9380715
[3-(cyanomethyl)-4-oxoquinazolin-2-yl]methyl 4-methoxy-1-phenylpyrazole-3-carboxylate (PubChem CID 9380715) has the molecular formula C22H17N5O4 and a molecular weight of 415.41 g/mol. Its IUPAC name is [3-(cyanomethyl)-4-oxoquinazolin-2-yl]methyl 4-methoxy-1-phenylpyrazole-3-carboxylate.
| Compound Name | [3-(cyanomethyl)-4-oxoquinazolin-2-yl]methyl 4-methoxy-1-phenylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 9380715 |
| Molecular Formula | C22H17N5O4 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | [3-(cyanomethyl)-4-oxoquinazolin-2-yl]methyl 4-methoxy-1-phenylpyrazole-3-carboxylate |
| SMILES | COc1cn(-c2ccccc2)nc1C(=O)OCc1nc2ccccc2c(=O)n1CC#N |
| InChI | InChI=1S/C22H17N5O4/c1-30-18-13-27(15-7-3-2-4-8-15)25-20(18)22(29)31-14-19-24-17-10-6-5-9-16(17)21(28)26(19)12-11-23/h2-10,13H,12,14H2,1H3 |
| InChIKey | RFDTXBMWXNPLIE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 112.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |